상품명칭 |
Cinnamylidenemalonic acid |
별명 |
2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
분자식 |
C12H8O4 |
분자량 |
216.1906 |
InChI |
InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
cas번호 |
4472-92-8 |
EC번호 |
224-746-3 |
분자 구조 |
|
비등점 |
484.6°C at 760 mmHg |
인화점 |
261°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|