Nama produk |
Cinnamylidenemalonic acid |
Sinonim |
2-Carboxy-5-phenyl-2,4-pentadienoic acid; (3-phenylprop-2-en-1-ylidene)propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioic acid; [(2E)-3-phenylprop-2-en-1-ylidene]propanedioate |
MF |
C12H8O4 |
Berat Molekul |
216.1906 |
InChI |
InChI=1/C12H10O4/c13-11(14)10(12(15)16)8-4-7-9-5-2-1-3-6-9/h1-8H,(H,13,14)(H,15,16)/p-2/b7-4+ |
CAS NO |
4472-92-8 |
EINECS |
224-746-3 |
Struktur Molekul |
|
Titik didih |
484.6°C at 760 mmHg |
Titik nyala |
261°C |
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|