product Name |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
Synonyms |
4-[(3-methoxyphenyl)acetyl]benzonitrile |
Molecular Formula |
C16H13NO2 |
Molecular Weight |
251.2799 |
InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
CAS Registry Number |
465514-67-4 |
Molecular Structure |
|
Density |
1.18g/cm3 |
Melting point |
113.9℃ |
Boiling point |
445.6°C at 760 mmHg |
Refractive index |
1.592 |
Flash point |
194.4°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|