Nazwa produktu: |
4-[2-(3-methoxyphenyl)acetyl]benzonitrile |
Synonimy |
4-[(3-methoxyphenyl)acetyl]benzonitrile |
MF |
C16H13NO2 |
Masie cząsteczkowej |
251.2799 |
InChI |
InChI=1/C16H13NO2/c1-19-15-4-2-3-13(9-15)10-16(18)14-7-5-12(11-17)6-8-14/h2-9H,10H2,1H3 |
Nr CAS |
465514-67-4 |
Struktury molekularnej |
|
Gęstość |
1.18g/cm3 |
Temperatura topnienia |
113.9℃ |
Temperatura wrzenia |
445.6°C at 760 mmHg |
Współczynnik załamania |
1.592 |
Temperatura zapłonu |
194.4°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|