نام محصول |
2,4-Dihydroxy-3,6-dimethylbenzoic acid |
مترادف |
3,6-Dimethyl-2,4-dihydroxybenzoic acid |
میدان مغناطیسی |
C9H10O4 |
وزن مولکولی |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
شماره سیایاس |
4707-46-4 |
ساختار مولکولی |
|
تراکم |
1.386g/cm3 |
نقطه غلیان |
407.4°C at 760 mmHg |
ضریب شکست |
1.627 |
نقطه اشتعال |
214.3°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|