Naam product |
2,4-Dihydroxy-3,6-dimethylbenzoic acid |
Synoniemen |
3,6-Dimethyl-2,4-dihydroxybenzoic acid |
MF |
C9H10O4 |
Molecuulgewicht |
182.1733 |
InChI |
InChI=1/C9H10O4/c1-4-3-6(10)5(2)8(11)7(4)9(12)13/h3,10-11H,1-2H3,(H,12,13) |
CAS-nummer |
4707-46-4 |
Moleculaire Structuur |
|
Dichtheid |
1.386g/cm3 |
Kookpunt |
407.4°C at 760 mmHg |
Brekingsindex |
1.627 |
Vlampunt |
214.3°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|