نام محصول |
Tetrahydrofuran-2,4-dione |
مترادف |
Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
میدان مغناطیسی |
C4H4O3 |
وزن مولکولی |
100.0728 |
InChI |
InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
شماره سیایاس |
4971-56-6 |
تعداد کمیسیون اروپایی |
225-617-4 |
ساختار مولکولی |
|
تراکم |
1.375g/cm3 |
نقطه ذوب |
142-147℃ |
نقطه غلیان |
324.3°C at 760 mmHg |
ضریب شکست |
1.47 |
نقطه اشتعال |
151.1°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|