اسم المنتج |
Tetrahydrofuran-2,4-dione |
الاسم المستعار |
Tetronicacidmin; beta-oxo-gamma-butyrolactone; 4-Hydroxy-2(5H)-furanone; Tetrahydro-2,4-furandione; 2,4(3H,5H)-Furandione; furan-2,4(3H,5H)-dione |
الصيغة الجزيئية |
C4H4O3 |
الوزن الجزيئي الغرامي |
100.0728 |
InChI |
InChI=1/C4H4O3/c5-3-1-4(6)7-2-3/h1-2H2 |
إستراتيجية المساعدة القطرية |
4971-56-6 |
المفوضية الأوروبية رقم |
225-617-4 |
بنية جزيئية |
|
كثافة |
1.375g/cm3 |
درجة الإنصهار |
142-147℃ |
نقطة الغليان |
324.3°C at 760 mmHg |
معامل الإنكسار |
1.47 |
نقطة الوميض |
151.1°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|