product Name |
2,3-Dibromosuccinic acid |
Synonyms |
Dibromosuccinicacid; 2,3-Dibromosucinic Acid; 2,3-Dibromo Dibutyric Acid; meso-2,3-Dibromosuccinic acid; (2R,3S)-2,3-dibromobutanedioic acid; (2R,3S)-2,3-dibromobutanedioate |
Molecular Formula |
C4H2Br2O4 |
Molecular Weight |
273.8654 |
InChI |
InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
CAS Registry Number |
526-78-3;608-35-5;608-36-6 |
EINECS |
208-396-9 |
Molecular Structure |
|
Melting point |
255-260℃ |
Boiling point |
262.4°C at 760 mmHg |
Flash point |
112.5°C |
Water solubility |
20 g/L (17℃) |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|