نام محصول |
2,3-Dibromosuccinic acid |
مترادف |
Dibromosuccinicacid; 2,3-Dibromosucinic Acid; 2,3-Dibromo Dibutyric Acid; meso-2,3-Dibromosuccinic acid; (2R,3S)-2,3-dibromobutanedioic acid; (2R,3S)-2,3-dibromobutanedioate |
میدان مغناطیسی |
C4H2Br2O4 |
وزن مولکولی |
273.8654 |
InChI |
InChI=1/C4H4Br2O4/c5-1(3(7)8)2(6)4(9)10/h1-2H,(H,7,8)(H,9,10)/p-2/t1-,2+ |
شماره سیایاس |
526-78-3;608-35-5;608-36-6 |
تعداد کمیسیون اروپایی |
208-396-9 |
ساختار مولکولی |
|
نقطه ذوب |
255-260℃ |
نقطه غلیان |
262.4°C at 760 mmHg |
نقطه اشتعال |
112.5°C |
حلالیت آب |
20 g/L (17℃) |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|