상품명칭 |
1-(2-Phenylethyl)piperazine |
별명 |
1-(Phenethyl)piperazine; 1-phenylethyl piperazine; N-(2-Phenylethyl)piperazine; 1-(2-cyclohexylethyl)piperazinediium |
분자식 |
C12H26N2 |
분자량 |
198.3471 |
InChI |
InChI=1/C12H24N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h12-13H,1-11H2/p+2 |
cas번호 |
5321-49-3 |
EC번호 |
226-186-5 |
분자 구조 |
|
비등점 |
277.1°C at 760 mmHg |
인화점 |
99°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|