Nazwa produktu: |
1-(2-Phenylethyl)piperazine |
Synonimy |
1-(Phenethyl)piperazine; 1-phenylethyl piperazine; N-(2-Phenylethyl)piperazine; 1-(2-cyclohexylethyl)piperazinediium |
MF |
C12H26N2 |
Masie cząsteczkowej |
198.3471 |
InChI |
InChI=1/C12H24N2/c1-2-4-12(5-3-1)6-9-14-10-7-13-8-11-14/h12-13H,1-11H2/p+2 |
Nr CAS |
5321-49-3 |
EINECS |
226-186-5 |
Struktury molekularnej |
|
Temperatura wrzenia |
277.1°C at 760 mmHg |
Temperatura zapłonu |
99°C |
Kody ryzyka |
R34:Causes burns.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|