product Name |
thiophene-2-carboximidamide hydrochloride |
Synonyms |
2-Amidinothiophene Hydrochloride |
Molecular Formula |
C5H7ClN2S |
Molecular Weight |
162.6405 |
InChI |
InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H |
CAS Registry Number |
54610-70-7 |
Molecular Structure |
|
Melting point |
172℃ |
Boiling point |
220.8°C at 760 mmHg |
Flash point |
87.3°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|