Ürün Adı |
thiophene-2-carboximidamide hydrochloride |
Eş anlamlı |
2-Amidinothiophene Hydrochloride |
Moleküler Formülü |
C5H7ClN2S |
Molekül Ağırlığı |
162.6405 |
InChI |
InChI=1/C5H6N2S.ClH/c6-5(7)4-2-1-3-8-4;/h1-3H,(H3,6,7);1H |
CAS kayıt numarası |
54610-70-7 |
Moleküler Yapısı |
|
Ergime noktası |
172℃ |
Kaynama noktası |
220.8°C at 760 mmHg |
Alevlenme noktası |
87.3°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|