produktnavn |
5-Chloro-2-methoxyphenyl isocyanate |
Synonymer |
4-chloro-2-isocyanato-1-methoxybenzene |
Molekylær Formel |
C8H6ClNO2 |
Molekylvekt |
183.5917 |
InChI |
InChI=1/C8H6ClNO2/c1-12-8-3-2-6(9)4-7(8)10-5-11/h2-4H,1H3 |
CAS-nummer |
55440-54-5 |
Molecular Structure |
|
Tetthet |
1.22g/cm3 |
Kokepunkt |
271.7°C at 760 mmHg |
Brytningsindeks |
1.534 |
Flammepunktet |
118.1°C |
Risiko Koder |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
Sikkerhet Beskrivelse |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|