اسم المنتج |
5-Chloro-2-methoxyphenyl isocyanate |
الاسم المستعار |
4-chloro-2-isocyanato-1-methoxybenzene |
الصيغة الجزيئية |
C8H6ClNO2 |
الوزن الجزيئي الغرامي |
183.5917 |
InChI |
InChI=1/C8H6ClNO2/c1-12-8-3-2-6(9)4-7(8)10-5-11/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
55440-54-5 |
بنية جزيئية |
|
كثافة |
1.22g/cm3 |
نقطة الغليان |
271.7°C at 760 mmHg |
معامل الإنكسار |
1.534 |
نقطة الوميض |
118.1°C |
خطر المصطلحات |
R23/25:Toxic by inhalation and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42:May cause sensitization by inhalation.;
|
شروط الأمن |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|