product Name |
2-Bromooctane |
Synonyms |
sec-Octyl bromide; 1-Methylheptyl bromide; 2-Bromoooctane; 2-Octyl bromide; NSC 8060; sec-Octyl bromide (VAN); Octane, 2-bromo- |
Molecular Formula |
C8H17Br |
Molecular Weight |
193.1246 |
InChI |
InChI=1/C8H17Br/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
CAS Registry Number |
557-35-7 |
EINECS |
209-171-8 |
Molecular Structure |
|
Density |
1.108g/cm3 |
Boiling point |
190.8°C at 760 mmHg |
Refractive index |
1.45 |
Flash point |
56.1°C |
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|