Naam product |
2-Bromooctane |
Synoniemen |
sec-Octyl bromide; 1-Methylheptyl bromide; 2-Bromoooctane; 2-Octyl bromide; NSC 8060; sec-Octyl bromide (VAN); Octane, 2-bromo- |
MF |
C8H17Br |
Molecuulgewicht |
193.1246 |
InChI |
InChI=1/C8H17Br/c1-3-4-5-6-7-8(2)9/h8H,3-7H2,1-2H3 |
CAS-nummer |
557-35-7 |
EINECS |
209-171-8 |
Moleculaire Structuur |
|
Dichtheid |
1.108g/cm3 |
Kookpunt |
190.8°C at 760 mmHg |
Brekingsindex |
1.45 |
Vlampunt |
56.1°C |
Veiligheid Omschrijving |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|