상품명칭 |
2,3-Dimethoxybenzonitrile |
별명 |
Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
분자식 |
C9H9NO2 |
분자량 |
163.17 |
InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
cas번호 |
5653-62-3 |
EC번호 |
227-097-4 |
분자 구조 |
|
녹는 점 |
41-46℃ |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|