Nazwa produktu: |
2,3-Dimethoxybenzonitrile |
Synonimy |
Benzonitrile, 2,3-dimethoxy-; 4-10-00-01418 (Beilstein Handbook Reference); BRN 2719631; NSC 27018; o-Veratronitrile (8CI) |
MF |
C9H9NO2 |
Masie cząsteczkowej |
163.17 |
InChI |
InChI=1/C9H9NO2/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-5H,1-2H3 |
Nr CAS |
5653-62-3 |
EINECS |
227-097-4 |
Struktury molekularnej |
|
Temperatura topnienia |
41-46℃ |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|