نام محصول |
4'-(4-bromophenyl)acetophenone |
مترادف |
Acetylbromodiphenyl; 4-Acetyl-4-bromodiphenyl; 1-(4'-bromobiphenyl-4-yl)ethanone; 4'-Bromo-4-acetylbiphenyl |
میدان مغناطیسی |
C14H11BrO |
وزن مولکولی |
275.1405 |
InChI |
InChI=1/C14H11BrO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h2-9H,1H3 |
شماره سیایاس |
5731-01-1 |
تعداد کمیسیون اروپایی |
227-236-9 |
ساختار مولکولی |
|
تراکم |
1.359g/cm3 |
نقطه غلیان |
372.1°C at 760 mmHg |
ضریب شکست |
1.592 |
نقطه اشتعال |
76.7°C |
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|