Ürün Adı |
4'-(4-bromophenyl)acetophenone |
Eş anlamlı |
Acetylbromodiphenyl; 4-Acetyl-4-bromodiphenyl; 1-(4'-bromobiphenyl-4-yl)ethanone; 4'-Bromo-4-acetylbiphenyl |
Moleküler Formülü |
C14H11BrO |
Molekül Ağırlığı |
275.1405 |
InChI |
InChI=1/C14H11BrO/c1-10(16)11-2-4-12(5-3-11)13-6-8-14(15)9-7-13/h2-9H,1H3 |
CAS kayıt numarası |
5731-01-1 |
EINECS |
227-236-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.359g/cm3 |
Kaynama noktası |
372.1°C at 760 mmHg |
Kırılma indisi |
1.592 |
Alevlenme noktası |
76.7°C |
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|