product Name |
N-Acetylthiourea |
Synonyms |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
Molecular Formula |
C3H6N2OS |
Molecular Weight |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
CAS Registry Number |
591-08-2 |
EINECS |
209-699-9 |
Molecular Structure |
|
Density |
1.275g/cm3 |
Melting point |
166-168℃ |
Boiling point |
208.6°C at 760 mmHg |
Refractive index |
1.569 |
Flash point |
80°C |
Hazard Symbols |
T:Toxic;
|
Risk Codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|