نام محصول |
N-Acetylthiourea |
مترادف |
N-Acetylthiourea,98%; N-carbamothioylacetamide |
میدان مغناطیسی |
C3H6N2OS |
وزن مولکولی |
118.1575 |
InChI |
InChI=1/C3H6N2OS/c1-2(6)5-3(4)7/h1H3,(H3,4,5,6,7) |
شماره سیایاس |
591-08-2 |
تعداد کمیسیون اروپایی |
209-699-9 |
ساختار مولکولی |
|
تراکم |
1.275g/cm3 |
نقطه ذوب |
166-168℃ |
نقطه غلیان |
208.6°C at 760 mmHg |
ضریب شکست |
1.569 |
نقطه اشتعال |
80°C |
خطر نمادها |
T:Toxic;
|
کدهای خطر |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|