نام محصول |
4-Iodobenzylamine hydrochloride |
مترادف |
1-(4-iodophenyl)methanamine hydrochloride (1:1) |
میدان مغناطیسی |
C7H9ClIN |
وزن مولکولی |
269.5105 |
InChI |
InChI=1/C7H8IN.ClH/c8-7-3-1-6(5-9)2-4-7;/h1-4H,5,9H2;1H |
شماره سیایاس |
59528-27-7 |
ساختار مولکولی |
|
نقطه غلیان |
286.5°C at 760 mmHg |
نقطه اشتعال |
127.1°C |
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|