상품명칭 |
4-Iodobenzylamine hydrochloride |
별명 |
1-(4-iodophenyl)methanamine hydrochloride (1:1) |
분자식 |
C7H9ClIN |
분자량 |
269.5105 |
InChI |
InChI=1/C7H8IN.ClH/c8-7-3-1-6(5-9)2-4-7;/h1-4H,5,9H2;1H |
cas번호 |
59528-27-7 |
분자 구조 |
|
비등점 |
286.5°C at 760 mmHg |
인화점 |
127.1°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|