product Name |
3-Hydroxy-2-Methyl Benzoic Acid |
Synonyms |
3-Hydroxy-2-methylbenzoic acid; Hydroxytoluicacid; 3-Hydroxy-o-toluic acid; 2-methyl-3-hydroxybenzoic acid; 3-hydroxy-2-methylbenzoate; 2-Methyl-3-hydroxy benzoic acid |
Molecular Formula |
C8H7O3 |
Molecular Weight |
151.1399 |
InChI |
InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
CAS Registry Number |
603-80-5 |
Molecular Structure |
|
Melting point |
143-148℃ |
Boiling point |
336.6°C at 760 mmHg |
Flash point |
171.6°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|