상품명칭 |
3-Hydroxy-2-Methyl Benzoic Acid |
별명 |
3-Hydroxy-2-methylbenzoic acid; Hydroxytoluicacid; 3-Hydroxy-o-toluic acid; 2-methyl-3-hydroxybenzoic acid; 3-hydroxy-2-methylbenzoate; 2-Methyl-3-hydroxy benzoic acid |
분자식 |
C8H7O3 |
분자량 |
151.1399 |
InChI |
InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
cas번호 |
603-80-5 |
분자 구조 |
|
녹는 점 |
143-148℃ |
비등점 |
336.6°C at 760 mmHg |
인화점 |
171.6°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|