Naam product |
3,5-Dimethoxy-4-methylbenzoic acid |
Synoniemen |
3,5-Dimethoxy-p-toluic acid (COOH=1) |
MF |
C10H12O4 |
Molecuulgewicht |
196.1999 |
InChI |
InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12) |
CAS-nummer |
61040-81-1 |
Moleculaire Structuur |
|
Dichtheid |
1.18g/cm3 |
Smeltpunt |
211-216℃ |
Kookpunt |
347.7°C at 760 mmHg |
Brekingsindex |
1.53 |
Vlampunt |
137.8°C |
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|