3,5-Dimethoxy-4-methylbenzoic acid

اسم المنتج	3,5-Dimethoxy-4-methylbenzoic acid
الاسم المستعار	3,5-Dimethoxy-p-toluic acid (COOH=1)
الصيغة الجزيئية	C₁₀H₁₂O₄
الوزن الجزيئي الغرامي	196.1999
InChI	InChI=1/C10H12O4/c1-6-8(13-2)4-7(10(11)12)5-9(6)14-3/h4-5H,1-3H3,(H,11,12)
إستراتيجية المساعدة القطرية	61040-81-1
بنية جزيئية
كثافة	1.18g/cm³
درجة الإنصهار	211-216℃
نقطة الغليان	347.7°C at 760 mmHg
معامل الإنكسار	1.53
نقطة الوميض	137.8°C
خطر المصطلحات	R36/37/38:Irritating to eyes, respiratory system and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;