product Name |
Tetramethyl 1,2,4,5-Benzenetetracarboxylate |
Synonyms |
Tetramethyl pyromellitate; Pyromellitic acid tetramethyl ester~Tetramethyl benzene-1,2,4,5-tetracarboxylate; tetramethyl benzene-1,2,4,5-tetracarboxylate |
Molecular Formula |
C14H14O8 |
Molecular Weight |
310.2562 |
InChI |
InChI=1/C14H14O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h5-6H,1-4H3 |
CAS Registry Number |
635-10-9 |
EINECS |
211-226-6 |
Molecular Structure |
|
Density |
1.287g/cm3 |
Boiling point |
370.9°C at 760 mmHg |
Refractive index |
1.52 |
Flash point |
161.5°C |
Safety Description |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|