Nome do produto |
Tetramethyl 1,2,4,5-Benzenetetracarboxylate |
Sinônimos |
Tetramethyl pyromellitate; Pyromellitic acid tetramethyl ester~Tetramethyl benzene-1,2,4,5-tetracarboxylate; tetramethyl benzene-1,2,4,5-tetracarboxylate |
Fórmula molecular |
C14H14O8 |
Peso Molecular |
310.2562 |
InChI |
InChI=1/C14H14O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h5-6H,1-4H3 |
CAS Registry Number |
635-10-9 |
EINECS |
211-226-6 |
Estrutura Molecular |
|
Densidade |
1.287g/cm3 |
Ponto de ebulição |
370.9°C at 760 mmHg |
índice de refração |
1.52 |
O ponto de inflamação |
161.5°C |
Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|