product Name |
3-amino-4-(methylamino)benzonitrile |
Molecular Formula |
C8H9N3 |
Molecular Weight |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
CAS Registry Number |
64910-46-9 |
Molecular Structure |
|
Density |
1.155g/cm3 |
Melting point |
136℃ |
Boiling point |
346.783°C at 760 mmHg |
Refractive index |
1.593 |
Flash point |
163.529°C |
Hazard Symbols |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|