Nazwa produktu: |
3-amino-4-(methylamino)benzonitrile |
MF |
C8H9N3 |
Masie cząsteczkowej |
147.1772 |
InChI |
InChI=1/C8H9N3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,11H,10H2,1H3 |
Nr CAS |
64910-46-9 |
Struktury molekularnej |
|
Gęstość |
1.155g/cm3 |
Temperatura topnienia |
136℃ |
Temperatura wrzenia |
346.783°C at 760 mmHg |
Współczynnik załamania |
1.593 |
Temperatura zapłonu |
163.529°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|