שם המוצר |
isooctadecanoic acid, monoester with glycerol |
נרדפות |
Glyceryl isostearate; Glyceryl monoisostearate; Isooctadecanoic acid, monoester with 1,2,3-propanetriol; Glycerol monoisostearate; Isostearic acid, 1,2,3-propaneriol ester (1:1); Isooctadecanoic acid, monoester with glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl 16-methylheptadecanoate |
מולקולרית פורמולה |
C21H42O4 |
משקל מולקולרי |
358.5558 |
InChI |
InChI=1/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-20(17-22)18-23/h19-20,22-23H,3-18H2,1-2H3 |
מספר CAS |
66085-00-5 |
EINECS |
266-124-4 |
מבנה מולקולרי |
|
צפיפות |
0.957g/cm3 |
נקודת רתיחה |
481.5°C at 760 mmHg |
משקל סגולי |
1.468 |
נקודת הבזק |
153.8°C |
|