उत्पाद का नाम |
isooctadecanoic acid, monoester with glycerol |
समानार्थी |
Glyceryl isostearate; Glyceryl monoisostearate; Isooctadecanoic acid, monoester with 1,2,3-propanetriol; Glycerol monoisostearate; Isostearic acid, 1,2,3-propaneriol ester (1:1); Isooctadecanoic acid, monoester with glycerol; 2-hydroxy-1-(hydroxymethyl)ethyl 16-methylheptadecanoate |
आणविक फार्मूला |
C21H42O4 |
आण्विक वजन |
358.5558 |
InChI |
InChI=1/C21H42O4/c1-19(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-21(24)25-20(17-22)18-23/h19-20,22-23H,3-18H2,1-2H3 |
कैस रजिस्टी संख्या |
66085-00-5 |
EINECS |
266-124-4 |
आणविक संरचना |
|
घनत्व |
0.957g/cm3 |
उबलने का समय |
481.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.468 |
फ्लैश प्वाइंट |
153.8°C |
|