product Name |
ethyl 3-amino-4-(methylamino)benzoate |
Synonyms |
-ETHYL 3-AMINO-4-(METHYLAMINO)BENZOATE; 3-Amino-4-(methylamino)benzoic acid ethyl ester |
Molecular Formula |
C10H14N2O2 |
Molecular Weight |
194.2304 |
InChI |
InChI=1/C10H14N2O2/c1-3-14-10(13)7-4-5-9(12-2)8(11)6-7/h4-6,12H,3,11H2,1-2H3 |
CAS Registry Number |
66315-23-9 |
Molecular Structure |
|
Density |
1.173g/cm3 |
Melting point |
81℃ |
Boiling point |
357.396°C at 760 mmHg |
Refractive index |
1.598 |
Flash point |
169.948°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|