Nama produk |
ethyl 3-amino-4-(methylamino)benzoate |
Sinonim |
-ETHYL 3-AMINO-4-(METHYLAMINO)BENZOATE; 3-Amino-4-(methylamino)benzoic acid ethyl ester |
MF |
C10H14N2O2 |
Berat Molekul |
194.2304 |
InChI |
InChI=1/C10H14N2O2/c1-3-14-10(13)7-4-5-9(12-2)8(11)6-7/h4-6,12H,3,11H2,1-2H3 |
CAS NO |
66315-23-9 |
Struktur Molekul |
|
Kepadatan |
1.173g/cm3 |
Titik lebur |
81℃ |
Titik didih |
357.396°C at 760 mmHg |
Indeks bias |
1.598 |
Titik nyala |
169.948°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|