상품명칭 |
1-(3-Chlorophenyl)piperazine |
별명 |
3-Chlorphenylpiperazine; 1-(3-Chlorphenyl)-piperazine; 3-Chlorophenyl piperazine; 1-(3-Chlorophenyl)-piperazine |
분자식 |
C10H13ClN2 |
분자량 |
196.6766 |
InChI |
InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
cas번호 |
6640-24-0 |
EC번호 |
229-654-7 |
분자 구조 |
|
밀도 |
1.159g/cm3 |
녹는 점 |
210-214℃ |
비등점 |
336.4°C at 760 mmHg |
굴절 지수 |
1.557 |
인화점 |
157.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|