Naam product |
1-(3-Chlorophenyl)piperazine |
Synoniemen |
3-Chlorphenylpiperazine; 1-(3-Chlorphenyl)-piperazine; 3-Chlorophenyl piperazine; 1-(3-Chlorophenyl)-piperazine |
MF |
C10H13ClN2 |
Molecuulgewicht |
196.6766 |
InChI |
InChI=1/C10H13ClN2/c11-9-2-1-3-10(8-9)13-6-4-12-5-7-13/h1-3,8,12H,4-7H2 |
CAS-nummer |
6640-24-0 |
EINECS |
229-654-7 |
Moleculaire Structuur |
|
Dichtheid |
1.159g/cm3 |
Smeltpunt |
210-214℃ |
Kookpunt |
336.4°C at 760 mmHg |
Brekingsindex |
1.557 |
Vlampunt |
157.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|