상품명칭 |
4-Bromo-2-methylbenzoic acid |
별명 |
2-Methyl-4-Bromobenzoic acid; RARECHEM AL BO 0455; 4-Bromo-o-toluic acid |
분자식 |
C8H7BrO2 |
분자량 |
215.044 |
InChI |
InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
cas번호 |
68837-59-2 |
EC번호 |
272-437-7 |
분자 구조 |
|
밀도 |
1.599g/cm3 |
녹는 점 |
180-184℃ |
비등점 |
310.1°C at 760 mmHg |
굴절 지수 |
1.595 |
인화점 |
141.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|