Naam product |
4-Bromo-2-methylbenzoic acid |
Synoniemen |
2-Methyl-4-Bromobenzoic acid; RARECHEM AL BO 0455; 4-Bromo-o-toluic acid |
MF |
C8H7BrO2 |
Molecuulgewicht |
215.044 |
InChI |
InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
CAS-nummer |
68837-59-2 |
EINECS |
272-437-7 |
Moleculaire Structuur |
|
Dichtheid |
1.599g/cm3 |
Smeltpunt |
180-184℃ |
Kookpunt |
310.1°C at 760 mmHg |
Brekingsindex |
1.595 |
Vlampunt |
141.3°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|