product Name |
2,6-Dibromotoluene |
Synonyms |
1,3-dibromo-2-methylbenzene |
Molecular Formula |
C7H6Br2 |
Molecular Weight |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS Registry Number |
69321-60-4 |
Molecular Structure |
|
Density |
1.81g/cm3 |
Boiling point |
246°C at 760 mmHg |
Refractive index |
1.587 |
Flash point |
106.6°C |
Risk Codes |
R36/38:Irritating to eyes and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|