Nome do produto |
2,6-Dibromotoluene |
Sinônimos |
1,3-dibromo-2-methylbenzene |
Fórmula molecular |
C7H6Br2 |
Peso Molecular |
249.9305 |
InChI |
InChI=1/C7H6Br2/c1-5-6(8)3-2-4-7(5)9/h2-4H,1H3 |
CAS Registry Number |
69321-60-4 |
Estrutura Molecular |
|
Densidade |
1.81g/cm3 |
Ponto de ebulição |
246°C at 760 mmHg |
índice de refração |
1.587 |
O ponto de inflamação |
106.6°C |
Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|