상품명칭 |
2-chloro-4-fluoroacetophenone |
별명 |
2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
분자식 |
C8H6ClFO |
분자량 |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
cas번호 |
700-35-6 |
분자 구조 |
|
밀도 |
1.259g/cm3 |
비등점 |
203.4°C at 760 mmHg |
굴절 지수 |
1.512 |
인화점 |
76.814°C |
리스크 규칙 |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|