اسم المنتج |
2-chloro-4-fluoroacetophenone |
الاسم المستعار |
2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
الصيغة الجزيئية |
C8H6ClFO |
الوزن الجزيئي الغرامي |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
إستراتيجية المساعدة القطرية |
700-35-6 |
بنية جزيئية |
|
كثافة |
1.259g/cm3 |
نقطة الغليان |
203.4°C at 760 mmHg |
معامل الإنكسار |
1.512 |
نقطة الوميض |
76.814°C |
خطر المصطلحات |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|