Nome del prodotto |
4-Amino-5-chloro-2-methoxybenzoic acid |
Sinonimi |
4-amino-5-chloro-2-methoxybenzoate |
Formula molecolare |
C8H7ClNO3 |
Peso Molecolare |
200.5996 |
InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
Numero CAS |
7206-70-4 |
EINECS |
230-582-3 |
Struttura molecolare |
|
Punto di fusione |
206-210℃ |
Punto di ebollizione |
369.7°C at 760 mmHg |
Punto d'infiammabilità |
177.4°C |
Simboli di pericolo |
Xn:Harmful;
|
Codici di Rischio |
R22:Harmful if swallowed.;
|
Sicurezza Descrizione |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|