상품명칭 |
4-Amino-5-chloro-2-methoxybenzoic acid |
별명 |
4-amino-5-chloro-2-methoxybenzoate |
분자식 |
C8H7ClNO3 |
분자량 |
200.5996 |
InChI |
InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12)/p-1 |
cas번호 |
7206-70-4 |
EC번호 |
230-582-3 |
분자 구조 |
|
녹는 점 |
206-210℃ |
비등점 |
369.7°C at 760 mmHg |
인화점 |
177.4°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
|
보안 규칙 |
S28B:After contact with skin, wash immediately with plenty of water and soap.;
S38:In case of insufficient ventilation, wear suitable respiratory equipment.;
|
|