상품명칭 |
Bromodichloromethane |
별명 |
FC-20B1 |
분자식 |
CHBrCl2 |
분자량 |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
cas번호 |
75-27-4 |
EC번호 |
200-856-7 |
분자 구조 |
|
밀도 |
2.013g/cm3 |
녹는 점 |
-55℃ |
비등점 |
89.7°C at 760 mmHg |
굴절 지수 |
1.503 |
인화점 |
1.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|