produktnavn |
Bromodichloromethane |
Synonymer |
FC-20B1 |
Molekylær Formel |
CHBrCl2 |
Molekylvekt |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
CAS-nummer |
75-27-4 |
EINECS |
200-856-7 |
Molecular Structure |
|
Tetthet |
2.013g/cm3 |
Smeltepunkt |
-55℃ |
Kokepunkt |
89.7°C at 760 mmHg |
Brytningsindeks |
1.503 |
Flammepunktet |
1.3°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|